CymitQuimica logo

CAS 85896-31-7

:

13-Tetradecenal

Description:
13-Tetradecenal is an unsaturated aldehyde characterized by a long carbon chain with a double bond located between the 13th and 14th carbon atoms. Its molecular formula is C14H26O, and it features a functional aldehyde group (-CHO) at one end of the carbon chain. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as fatty or waxy. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 13-Tetradecenal is known for its applications in the fragrance industry, where it is used to impart specific scents in perfumes and cosmetics. Additionally, it may serve as a precursor in organic synthesis and can be involved in various chemical reactions, including oxidation and polymerization. Its structural characteristics contribute to its reactivity and potential uses in various chemical processes. Safety precautions should be observed when handling this compound, as with many aldehydes, due to potential irritant properties.
Formula:C14H26O
InChI:InChI=1S/C14H26O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15/h2,14H,1,3-13H2
InChI key:InChIKey=ZVJRAGVPKPPDKE-UHFFFAOYSA-N
SMILES:C(CCCCCC=C)CCCCCC=O
Synonyms:
  • 13-Tetradecenal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.