CAS 859027-48-8
:(R)-1-Boc-3-((dimethylamino)methyl)pyrrolidine
Description:
(R)-1-Boc-3-((dimethylamino)methyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in organic synthesis, particularly in the protection of amines. The presence of the dimethylamino group indicates that the compound has basic properties, as this group can participate in hydrogen bonding and influence the compound's reactivity. The stereochemistry denoted by "(R)" indicates that the compound has a specific three-dimensional arrangement of atoms, which can significantly affect its biological activity and interactions. This compound is often utilized in pharmaceutical chemistry and organic synthesis, particularly in the development of various bioactive molecules. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a versatile intermediate in synthetic pathways. Overall, (R)-1-Boc-3-((dimethylamino)methyl)pyrrolidine is an important compound in medicinal chemistry and related fields.
Formula:C12H24N2O2
InChI:InChI=1/C12H24N2O2/c1-12(2,3)16-11(15)14-7-6-10(9-14)8-13(4)5/h10H,6-9H2,1-5H3/t10-/m1/s1
SMILES:CC(C)(C)OC(=O)N1CC[C@H](CN(C)C)C1
Synonyms:- (R)-1-tert-Butoxycarbonyl-3-((dimethylamino)methyl)pyrrolidine
- tert-butyl (3R)-3-(dimethylaminomethyl)pyrrolidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
