CAS 859082-28-3
:(3-chloro-1,2,2-trimethyl-3-oxo-propyl) acetate
Description:
(3-chloro-1,2,2-trimethyl-3-oxo-propyl) acetate, identified by its CAS number 859082-28-3, is an organic compound characterized by its ester functional group, which is derived from acetic acid. The presence of a chloro substituent indicates that it has halogenated properties, potentially affecting its reactivity and solubility. The compound features a ketone functional group, as indicated by the "3-oxo" designation, which suggests it may participate in various chemical reactions, such as nucleophilic additions. The trimethyl groups contribute to its steric bulk, which can influence its physical properties, such as boiling point and solubility in different solvents. Generally, compounds with similar structures may exhibit moderate to low volatility and can be used in various applications, including as intermediates in organic synthesis or in the formulation of specialty chemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C8H13ClO3
InChI:InChI=1/C8H13ClO3/c1-5(12-6(2)10)8(3,4)7(9)11/h5H,1-4H3
SMILES:CC(C(C)(C)C(=O)Cl)OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.