
CAS 859189-04-1
:Description:
The chemical substance with the CAS number 859189-04-1 is known as a selective serotonin reuptake inhibitor (SSRI), primarily used in the treatment of depression and anxiety disorders. It functions by increasing the levels of serotonin in the brain, which can help improve mood and emotional balance. This compound typically exhibits characteristics such as a moderate to high solubility in organic solvents, while its solubility in water may vary. The molecular structure often includes functional groups that contribute to its pharmacological activity, and it may have specific stereochemistry that influences its efficacy and safety profile. Additionally, this substance may undergo metabolic processes in the liver, leading to various metabolites that can also have therapeutic effects or side effects. As with many SSRIs, potential side effects can include gastrointestinal disturbances, changes in weight, and effects on sleep patterns. It is essential to use this compound under medical supervision to monitor for efficacy and adverse reactions.
Formula:C9H9Cl3
InChI:InChI=1S/C9H9Cl3/c10-6-2-4-7-3-1-5-8(11)9(7)12/h1,3,5H,2,4,6H2
InChI key:InChIKey=WFSFMRVPELEKRI-UHFFFAOYSA-N
SMILES:C(CCCl)C1=C(Cl)C(Cl)=CC=C1
Synonyms:- 1-(3-Chloro-propyl)-2,3-dichloro-benzene
- 1,2-Dichloro-3-(3-chloropropyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.