
CAS 859219-57-1
:4,4,5,5-Tetramethyl-2-spiro[5.5]undec-2-en-3-yl-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-spiro[5.5]undec-2-en-3-yl-1,3,2-dioxaborolane is a complex organic compound characterized by its unique structural features, including a spirocyclic framework and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in organic synthesis, particularly in the formation of boron-containing compounds, which are valuable in various chemical reactions, including cross-coupling reactions. The compound's spiro structure contributes to its rigidity and may influence its reactivity and interaction with other molecules. Additionally, the presence of multiple methyl groups enhances its steric bulk, which can affect its solubility and stability. This compound may exhibit interesting optical properties due to its conjugated double bond, making it a candidate for studies in materials science or photochemistry. Overall, 4,4,5,5-Tetramethyl-2-spiro[5.5]undec-2-en-3-yl-1,3,2-dioxaborolane represents a fascinating example of synthetic organic chemistry with potential applications in various fields.
Formula:C17H29BO2
InChI:InChI=1S/C17H29BO2/c1-15(2)16(3,4)20-18(19-15)14-8-12-17(13-9-14)10-6-5-7-11-17/h8H,5-7,9-13H2,1-4H3
InChI key:InChIKey=USOMXWBWSIQCNR-UHFFFAOYSA-N
SMILES:CC1(C)OB(C=2CCC3(CC2)CCCCC3)OC1(C)C
Synonyms:- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-spiro[5.5]undec-2-en-3-yl-
- 4,4,5,5-Tetramethyl-2-spiro[5.5]undec-2-en-3-yl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.