CymitQuimica logo

CAS 859239-29-5

:

3-(1-Methyl-1H-imidazol-5-yl)pyridine

Description:
3-(1-Methyl-1H-imidazol-5-yl)pyridine, identified by its CAS number 859239-29-5, is a heterocyclic organic compound featuring both pyridine and imidazole functional groups. This compound typically exhibits a pale to light yellow appearance and is soluble in polar organic solvents. Its molecular structure includes a pyridine ring substituted at the 3-position with a 1-methyl-1H-imidazole moiety, which contributes to its unique chemical properties. The presence of nitrogen atoms in both rings enhances its potential for coordination with metal ions, making it of interest in coordination chemistry and catalysis. Additionally, this compound may exhibit biological activity, potentially serving as a scaffold for drug development or as a ligand in biochemical applications. Its stability and reactivity can be influenced by the electronic effects of the nitrogen atoms and the overall molecular conformation. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the reaction conditions.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c1-12-7-11-6-9(12)8-3-2-4-10-5-8/h2-7H,1H3
InChI key:InChIKey=BWYNAQVMYILNCY-UHFFFAOYSA-N
SMILES:CN1C(=CN=C1)C=2C=CC=NC2
Synonyms:
  • 3-(1-Methyl-1H-imidazol-5-yl)pyridine
  • Pyridine, 3-(1-methyl-1H-imidazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.