CAS 859282-12-5
:(3′S)-1,3′-Bipyrrolidine
Description:
(3′S)-1,3′-Bipyrrolidine is a bicyclic organic compound characterized by its two pyrrolidine rings connected by a single bond. The "3′S" designation indicates the specific stereochemistry at the chiral center, which plays a crucial role in its biological activity and interactions. This compound is typically colorless to pale yellow and may exhibit a range of physical properties such as solubility in polar solvents due to the presence of nitrogen atoms in the pyrrolidine rings. It is of interest in various fields, including medicinal chemistry, due to its potential applications in drug development and as a building block for more complex molecules. The presence of nitrogen atoms contributes to its basicity and ability to form hydrogen bonds, which can influence its reactivity and interactions with other chemical species. Safety and handling considerations should be taken into account, as with many nitrogen-containing organic compounds, due to potential toxicity or reactivity. Overall, (3′S)-1,3′-Bipyrrolidine is a compound of significant interest in both academic and industrial research settings.
Formula:C8H16N2
InChI:InChI=1/C8H16N2/c1-2-6-10(5-1)8-3-4-9-7-8/h8-9H,1-7H2/t8-/m0/s1
InChI key:InChIKey=HFZLSTDPRQSZCQ-QMMMGPOBSA-N
SMILES:[C@@H]1(CCNC1)N2CCCC2
Synonyms:- (3S)-3-(Pyrrolidin-1-yl)pyrrolidine
- (3′S)-1,3′-Bipyrrolidine
- (S)-[1,3']Bipyrrolidinyl
- 1,3'-bipyrrolidine, (3'S)-
- 1,3′-Bipyrrolidine, (3′S)-
- 1-[(3S)-Pyrrolidin-3-yl]pyrrolidine
- (3'S)-1,3'-Bipyrrolidine
- 1-((S)-pyrrolidin-3-yl)pyrrolidine
- (S)-1,3'-bipyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
