CymitQuimica logo

CAS 859282-13-6

:

2-Amino-5-chloro-3-methoxybenzenethiol

Description:
2-Amino-5-chloro-3-methoxybenzenethiol, with the CAS number 859282-13-6, is an organic compound that features a benzene ring substituted with an amino group, a chloro group, a methoxy group, and a thiol group. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the amino group (-NH2) indicates potential basicity and the ability to participate in hydrogen bonding, while the thiol group (-SH) provides nucleophilic properties, making it reactive towards electrophiles. The chloro substituent introduces a halogen, which can influence the compound's reactivity and solubility in various solvents. The methoxy group (-OCH3) enhances the compound's lipophilicity and can affect its electronic properties. Overall, 2-Amino-5-chloro-3-methoxybenzenethiol is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex chemical syntheses.
Formula:C7H8ClNOS
InChI:InChI=1S/C7H8ClNOS/c1-10-5-2-4(8)3-6(11)7(5)9/h2-3,11H,9H2,1H3
InChI key:InChIKey=GJMIWLWKAOAMRU-UHFFFAOYSA-N
SMILES:O(C)C1=C(N)C(S)=CC(Cl)=C1
Synonyms:
  • Benzenethiol, 2-amino-5-chloro-3-methoxy-
  • 2-Amino-5-chloro-3-methoxybenzenethiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.