CymitQuimica logo

CAS 859458-82-5

:

P-(10-Aminodecyl)phosphonic acid

Description:
P-(10-Aminodecyl)phosphonic acid is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and a long aliphatic chain. This compound features a primary amine group, which contributes to its potential as a chelating agent and its ability to form complexes with metal ions. The structure typically includes a phosphonic acid moiety, which imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The long carbon chain enhances its hydrophobic characteristics, which can influence its solubility and interaction with biological membranes. P-(10-Aminodecyl)phosphonic acid may find applications in fields such as biochemistry, materials science, and pharmaceuticals, particularly in drug delivery systems or as a surface modifier. Its unique combination of hydrophilic and hydrophobic properties makes it a versatile compound for various chemical and biological applications. As with many organophosphorus compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.
Formula:C10H24NO3P
InChI:InChI=1S/C10H24NO3P/c11-9-7-5-3-1-2-4-6-8-10-15(12,13)14/h1-11H2,(H2,12,13,14)
InChI key:InChIKey=JXCXYNMSRUFZJX-UHFFFAOYSA-N
SMILES:C(CCCCCCCN)CCP(=O)(O)O
Synonyms:
  • P-(10-Aminodecyl)phosphonic acid
  • Phosphonic acid, (10-aminodecyl)-
  • Phosphonic acid, P-(10-aminodecyl)-
  • 10-Aminodecylphosphonic acid
  • 10-Amino-1-decanephosphonic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.