CAS 85951-09-3
:4,8-Dioxa-3,9-disilaundecan-6-ol, 2,2,3,3,9,9,10,10-octamethyl-
Description:
4,8-Dioxa-3,9-disilaundecan-6-ol, 2,2,3,3,9,9,10,10-octamethyl- (CAS 85951-09-3) is a siloxane compound characterized by its unique structure that includes both siloxane (Si-O) linkages and hydroxyl functional groups. This compound typically exhibits properties associated with siloxanes, such as low surface tension, thermal stability, and resistance to moisture. The presence of multiple methyl groups contributes to its hydrophobic nature, enhancing its compatibility with organic solvents while reducing its solubility in water. Additionally, the hydroxyl group can participate in hydrogen bonding, which may influence its reactivity and interactions with other substances. This compound is often utilized in various applications, including as a surfactant, lubricant, or in the formulation of silicone-based materials. Its specific characteristics, such as viscosity and volatility, can vary depending on the molecular weight and the arrangement of its siloxane chains. Overall, 4,8-Dioxa-3,9-disilaundecan-6-ol is notable for its multifunctional properties, making it valuable in industrial and commercial applications.
Formula:C15H36O3Si2
InChI:InChI=1S/C15H36O3Si2/c1-14(2,3)19(7,8)17-11-13(16)12-18-20(9,10)15(4,5)6/h13,16H,11-12H2,1-10H3
InChI key:BICVCKKJDDTEIV-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-ol
CAS:2,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-olFormula:C15H36O3Si2Purity:98%Molecular weight:320.622,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-ol
CAS:Formula:C15H36O3Si2Purity:98%Color and Shape:LiquidMolecular weight:320.61552,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-ol
CAS:2,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-olFormula:C15H36O3Si2Purity:90%Molecular weight:320.621,3-Bis(tert-Butyldimethylsiloxy)-2-propanol
CAS:Controlled ProductApplications 1,3-Bis(tert-Butyldimethylsiloxy)-2-propanol is an intermediate in the synthesis of 2-Linoleoyl-rac-glycerol (L467960), which is a atty acid monoglycerides in vegetable oils with medium unsaturation.
References Compton, D., et al.: J. Pharmacol. Exp. Ther., 277, 586 (1996), Devane, W., et al.: Science, 258, 1946 (1992),Formula:C15H36O3Si2Color and Shape:NeatMolecular weight:320.622,2,3,3,9,9,10,10-OCTAMETHYL-4,8-DIOXA-3,9-DISILAUNDECAN-6-OL
CAS:Formula:C15H36O3Si2Purity:98%Color and Shape:LiquidMolecular weight:320.621,3-Bis(tert-Butyldimethylsiloxy)-2-propanol-d5
CAS:Controlled ProductApplications 1,3-Bis(tert-Butyldimethylsiloxy)-2-propanol-d5 is an intermediate used in the synthesis of 2-Linoleoyl-rac-glycerol-d5 (L467962), which is labelled 2-Linoleoyl-rac-glycerol (L467960) which is a fatty acid monoglycerides in vegetable oils with medium unsaturation.
References Compton, D., et al.: J. Pharmacol. Exp. Ther., 277, 586 (1996); Devane, W., et al.: Science, 258, 1946 (1992)Formula:C15D5H31O3Si2Color and Shape:NeatMolecular weight:325.646




