CAS 85951-62-8

Glycine, L-γ-glutamyl-S-[(1R,2E,4E,6Z,8E,10S)-1-[(1S)-4-carboxy-1-hydroxybutyl]-10-hydroxy-2,4,6,8-pentadecatetraenyl]-L-cysteinyl-

Description:

The chemical substance known as Glycine, L-γ-glutamyl-S-[(1R,2E,4E,6Z,8E,10S)-1-[(1S)-4-carboxy-1-hydroxybutyl]-10-hydroxy-2,4,6,8-pentadecatetraenyl]-L-cysteinyl- (CAS number 85951-62-8) is a complex peptide derivative. It features a glycine backbone, which is the simplest amino acid, and is modified with a γ-glutamyl group, indicating a connection to the amino acid glutamic acid. The presence of a cysteine residue suggests potential for disulfide bond formation, contributing to the molecule's structural stability. The compound also contains a long hydrocarbon chain with multiple double bonds, which may impart unique physical properties and biological activity. This structure suggests that it could play a role in biochemical processes, possibly as a signaling molecule or in cellular interactions. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the overall conformation and the presence of functional groups, making it a subject of interest in biochemical and pharmaceutical research.

Formula: C₃₀H₄₇N₃O₁₀S

InChI: InChI=1S/C30H47N3O10S/c1-2-3-8-12-21(34)13-9-6-4-5-7-10-15-25(24(35)14-11-16-27(37)38)44-20-23(29(41)32-19-28(39)40)33-26(36)18-17-22(31)30(42)43/h4-7,9-10,13,15,21-25,34-35H,2-3,8,11-12,14,16-20,31H2,1H3,(H,32,41)(H,33,36)(H,37,38)(H,39,40)(H,42,43)

InChI key: InChIKey=CYCIJLWHNZKKBC-UHFFFAOYSA-N

SMILES: C(CSC(C(CCCC(O)=O)O)C=CC=CC=CC=CC(CCCCC)O)(NC(CCC(C(O)=O)N)=O)C(NCC(O)=O)=O

Synonyms:

• Lipoxin C4
• Glycine, N-[S-[1-(4-carboxy-1-hydroxybutyl)-10-hydroxy-2,4,6,8-pentadecatetraenyl]-N-L-γ-glutamyl-L-cysteinyl]-, [1R-[1R*,1(S*),2E,4E,6Z,8E,10S*]]-
• Glycine, L-γ-glutamyl-S-[(1R,2E,4E,6Z,8E,10S)-1-[(1S)-4-carboxy-1-hydroxybutyl]-10-hydroxy-2,4,6,8-pentadecatetraenyl]-L-cysteinyl-

Lipoxin C4

CAS: 85951-62-8

Lipoxin C4, a nonclassic eicosanoid SPM, is a metabolite of arachidonic acid with bioactive properties, produced by various cells.

Formula: C₃₀H₄₇N₃O₁₀S

Color and Shape: Solid

Molecular weight: 641.77

Ref: TM-T32783