CAS 85951-63-9

N-{1-[2-(4-isothiocyanatophenyl)ethyl]piperidin-4-yl}-N-phenylpropanamide

Description:

N-{1-[2-(4-isothiocyanatophenyl)ethyl]piperidin-4-yl}-N-phenylpropanamide, with the CAS number 85951-63-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring, an isothiocyanate group, and an amide functional group. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential biological activity. The presence of the isothiocyanate moiety suggests that it may exhibit reactivity towards nucleophiles, making it of interest in the development of pharmaceuticals or agrochemicals. Additionally, the piperidine ring contributes to its ability to interact with biological targets, potentially influencing its pharmacological properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this substance represents a class of compounds that may have significant implications in drug discovery and development, particularly in targeting specific biological pathways or mechanisms.

Formula: C₂₃H₂₇N₃OS

InChI: InChI=1/C23H27N3OS/c1-2-23(27)26(21-6-4-3-5-7-21)22-13-16-25(17-14-22)15-12-19-8-10-20(11-9-19)24-18-28/h3-11,22H,2,12-17H2,1H3

SMILES: CCC(=O)N(c1ccccc1)C1CCN(CCc2ccc(cc2)N=C=S)CC1

Synonyms:

• Propanamide, N-(1-(2-(4-isothiocyanatophenyl)ethyl)-4-piperidinyl)-N-phenyl-
• N-{1-[2-(4-Isothiocyanatophenyl)ethyl]piperidin-4-yl}-N-phenylpropanamide

FIT

Controlled Product

CAS: 85951-63-9

Formula: C₂₃H₂₇N₃OS

Color and Shape: Neat

Molecular weight: 393.545

Ref: TR-F356085