CAS 85952-32-5

2-(Methanesulfonyl chloride)benzotrifluoride

Description:

2-(Methanesulfonyl chloride)benzotrifluoride, with the CAS number 85952-32-5, is an organic compound characterized by the presence of a benzene ring substituted with both a methanesulfonyl chloride group and three fluorine atoms. This compound typically appears as a colorless to pale yellow liquid and is known for its strong reactivity due to the presence of the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions. The trifluoromethyl groups enhance its electrophilic character and can influence its solubility and stability in various solvents. It is often used in organic synthesis as a reagent for introducing sulfonyl groups into other molecules. Additionally, the presence of fluorine atoms can impart unique properties, such as increased lipophilicity and altered electronic characteristics, making it valuable in the development of pharmaceuticals and agrochemicals. However, due to its reactive nature, appropriate safety measures should be taken when handling this compound, as it can be corrosive and harmful upon exposure.

Formula: C₈H₆ClF₃O₂S

InChI: InChI=1/C8H6ClF3O2S/c9-15(13,14)5-6-3-1-2-4-7(6)8(10,11)12/h1-4H,5H2

SMILES: c1ccc(c(c1)CS(=O)(=O)Cl)C(F)(F)F

Synonyms:

• (2-(Trifluoromethyl)Phenyl)Methanesulfonyl Chloride
• 2-Trifluoromethylbenzylsulfonyl Chloride

(2-(Trifluoromethyl)Phenyl)Methanesulfonyl Chloride

CAS: 85952-32-5

Formula: C₈H₆ClF₃O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 258.6452

Ref: IN-DA004QLB

[2-(Trifluoromethyl)phenyl]methanesulphonyl chloride

CAS: 85952-32-5

[2-(Trifluoromethyl)phenyl]methanesulphonyl chloride

Formula: C₈H₆ClF₃O₂S

Purity: ≥95%

Color and Shape: low melting solid

Molecular weight: 258.65g/mol

Ref: 54-PC50012

2-Trifluoromethylbenzylsulfonyl chloride

CAS: 85952-32-5

Formula: C₈H₆ClF₃O₂S

Purity: 97.0%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 258.64

Ref: 10-F024387