CAS 859525-68-1

Piperazine, 1-[(1-methyl-1H-imidazol-4-yl)sulfonyl]-, hydrochloride (1:1)

Description:

Piperazine, 1-[(1-methyl-1H-imidazol-4-yl)sulfonyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a sulfonyl group attached to a 1-methyl-1H-imidazole moiety, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. The presence of the imidazole ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly for its possible roles in drug development. The compound may exhibit various pharmacological effects, including antimicrobial or anti-inflammatory properties, although specific biological activities would depend on further empirical studies. Its CAS number, 859525-68-1, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status. Overall, this compound represents a class of piperazine derivatives that may have significant implications in therapeutic contexts.

Formula: C₈H₁₄N₄O₂S·ClH

InChI: InChI=1S/C8H14N4O2S.ClH/c1-11-6-8(10-7-11)15(13,14)12-4-2-9-3-5-12;/h6-7,9H,2-5H2,1H3;1H

InChI key: InChIKey=VAEMIXMTAIERRP-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CN(C)C=N1)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-[(1-methyl-1H-imidazol-4-yl)sulfonyl]-, hydrochloride (1:1)
• Piperazine, 1-[(1-methyl-1H-imidazol-4-yl)sulfonyl]-, monohydrochloride