CAS 859538-51-5

1-(4-Hydroxyphenyl)-2(1H)-pyridinone

Description:

1-(4-Hydroxyphenyl)-2(1H)-pyridinone, also known as a derivative of pyridinone, is a chemical compound characterized by its unique structural features, which include a pyridinone ring and a hydroxyl-substituted phenyl group. This compound typically exhibits properties such as solubility in organic solvents and moderate stability under standard conditions. It may display biological activity, particularly in the context of chelation, as pyridinones are known for their ability to bind metal ions. The presence of the hydroxyl group can enhance its reactivity and potential interactions with biological targets. Additionally, this compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a ligand in coordination chemistry. Its molecular structure allows for various functional modifications, which can lead to diverse derivatives with tailored properties. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₁H₉NO₂

InChI: InChI=1S/C11H9NO2/c13-10-6-4-9(5-7-10)12-8-2-1-3-11(12)14/h1-8,13H

InChI key: InChIKey=ORCWDXURTHUZTK-UHFFFAOYSA-N

SMILES: O=C1N(C2=CC=C(O)C=C2)C=CC=C1

Synonyms:

• LYT-104
• 1-(4-Hydroxyphenyl)-1,2-dihydropyridin-2-one
• 2(1H)-Pyridinone, 1-(4-hydroxyphenyl)-
• 1-(4-Hydroxyphenyl)-2(1H)-pyridinone
• 1-(4-Hydroxyphenyl)pyridin-2(1H)-one