CAS 85955-59-5
:(2S)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-phenyl-propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid
Description:
The chemical substance with the name "(2S)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-phenyl-propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid" and CAS number "85955-59-5" is a complex amino acid derivative. It features a pyrrolidine ring, which contributes to its cyclic structure, and contains multiple functional groups, including amino and carboxylic acid groups, which are characteristic of amino acids. The presence of stereocenters in its structure indicates that it exists in specific chiral forms, which can influence its biological activity and interactions. This compound is likely to be soluble in polar solvents due to its ionic and polar functional groups. Its structure suggests potential applications in pharmaceuticals, particularly in the development of peptide-based drugs or as a building block in synthetic organic chemistry. The specific arrangement of its substituents may also impart unique properties, making it of interest in biochemical research and drug design.
Formula:C21H31N3O5
InChI:InChI=1/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17+,18-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lisinopril EP Impurity E
CAS:Formula:C21H31N3O5Color and Shape:White To Off-White SolidMolecular weight:405.50Lisinopril EP Impurity E
CAS:Lisinopril EP Impurity E is an impurity of lisinopril, which is a prescription drug used to treat high blood pressure. This impurity was found in a preparative high performance liquid chromatography (HPLC) and mass spectroscopy analysis of the drug. The molecular weight of Lisinopril EP Impurity E was determined to be 317.2 amu, which corresponds to the molecular formula C7H13NO2. The FT-IR spectrum showed that this impurity has an ammonium group at 1859 cm-1 and butanoic acid at 1647 cm-1.Formula:C21H31N3O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:405.49 g/mol


