
CAS 85964-19-8
:4,5-Dihydro-5-methyl-1-(2-pyridinyl)-1H-pyrazol-3-amine
Description:
4,5-Dihydro-5-methyl-1-(2-pyridinyl)-1H-pyrazol-3-amine, with the CAS number 85964-19-8, is a chemical compound characterized by its pyrazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group at the 5-position and a pyridine ring at the 1-position, contributing to its unique chemical properties. It is typically classified as an amine due to the presence of an amino group (-NH2) at the 3-position of the pyrazole ring. The presence of both the pyridine and pyrazole moieties suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various physical properties, including solubility in polar solvents, and it may participate in hydrogen bonding due to its amine functionality. Its reactivity can be influenced by the electron-donating and withdrawing effects of the attached groups, which can affect its interaction with biological targets or other chemical species.
Formula:C9H12N4
InChI:InChI=1S/C9H12N4/c1-7-6-8(10)12-13(7)9-4-2-3-5-11-9/h2-5,7H,6H2,1H3,(H2,10,12)
InChI key:InChIKey=CXSZQVKNWNZACV-UHFFFAOYSA-N
SMILES:CC1N(N=C(N)C1)C2=CC=CC=N2
Synonyms:- 5-Methyl-1-(pyridin-2-yl)-4,5-dihydro-1H-pyrazol-3-amine
- 4,5-Dihydro-5-methyl-1-(2-pyridinyl)-1H-pyrazol-3-amine
- 1H-Pyrazol-3-amine, 4,5-dihydro-5-methyl-1-(2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.