CAS 85966-90-1
:3,5,9-Trioxa-4-phosphaheptacos-18-en-1-aminium, 7-(acetyloxy)-4-hydroxy-N,N,N-trimethyl-, inner salt, 4-oxide, (7R,18Z)-
Description:
3,5,9-Trioxa-4-phosphaheptacos-18-en-1-aminium, 7-(acetyloxy)-4-hydroxy-N,N,N-trimethyl-, inner salt, 4-oxide, (7R,18Z)- is a complex organic compound characterized by its unique structural features, including multiple functional groups such as aminium, hydroxy, and acetyloxy moieties. The presence of phosphorus in its structure indicates potential applications in areas like biochemistry and materials science, particularly in the development of phosphonium salts. The compound's inner salt form suggests it possesses both cationic and anionic characteristics, which can influence its solubility and reactivity in various solvents. The specific stereochemistry denoted by (7R,18Z) indicates the spatial arrangement of atoms, which can significantly affect the compound's biological activity and interaction with other molecules. Additionally, the presence of multiple oxygen atoms in the structure may contribute to its polar nature, enhancing its solubility in polar solvents. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C28H56NO7P
InChI:InChI=1S/C28H56NO7P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-33-25-28(36-27(2)30)26-35-37(31,32)34-24-22-29(3,4)5/h13-14,28H,6-12,15-26H2,1-5H3/b14-13-/t28-/m1/s1
InChI key:InChIKey=ZBOQHUSCQCEBGK-JLRCLJKCSA-N
SMILES:[C@H](COP(OCC[N+](C)(C)C)(=O)[O-])(COCCCCCCCC/C=C\CCCCCCCC)OC(C)=O
Synonyms:- 3,5,9-Trioxa-4-phosphaheptacos-18-en-1-aminium, 7-(acetyloxy)-4-hydroxy-N,N,N-trimethyl-, inner salt, 4-oxide, [R-(Z)]-
- 3,5,9-Trioxa-4-phosphaheptacos-18-en-1-aminium, 7-(acetyloxy)-4-hydroxy-N,N,N-trimethyl-, inner salt, 4-oxide, (7R,18Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
PAF C-18:1
CAS:PAF C-18:1: a cell-produced phospholipid for inflammation, weaker in neutrophil chemotaxis, equal for eosinophil migration, and used in PAF receptor studies.Formula:C28H56NO7PColor and Shape:SolidMolecular weight:549.731-O-(cis-9-Octadecenyl)-2-O-acetyl-sn-glycero-3-phosphocholine
CAS:1-O-(cis-9-Octadecenyl)-2-O-acetyl-sn-glycero-3-phosphocholine (Biotinylated BSA) is a categorized lipid that contains both carbohydrates and lipids. It is used to inseminate dairy cattle, but also has potential as a biomarker for fertility and metabolic diseases. Biotinylated BSA contains conjugates of fatty acids, which are important compounds in metabolism. The metabolome of biotinylated BSA includes nucleotides, carboxylic acids, and purines.Formula:C28H56NO7PPurity:Min. 95%Molecular weight:549.72 g/mol1-O-(cis-9-Octadecenyl)-2-O-acetyl-sn-glycero-3-phosphocholine
CAS:For tritiation.Formula:C28H56NO7PPurity:> 99%Molecular weight:549.73


