CymitQuimica logo

CAS 859775-82-9

:

ethyl 2-(2-methoxy-5-methyl-phenyl)-2-oxo-acetate

Description:
Ethyl 2-(2-methoxy-5-methyl-phenyl)-2-oxo-acetate, identified by its CAS number 859775-82-9, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a methoxy group and a methyl substituent on a phenyl ring, contributing to its unique chemical properties and potential reactivity. The presence of the keto group (2-oxo) indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Ethyl esters, in general, are known for their volatility and pleasant odors, which can make them useful in flavoring and fragrance applications. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility characteristics would typically depend on the polarity of the substituents, influencing its behavior in different solvents. Overall, ethyl 2-(2-methoxy-5-methyl-phenyl)-2-oxo-acetate represents a versatile structure with potential applications in organic synthesis and medicinal chemistry.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-4-16-12(14)11(13)9-7-8(2)5-6-10(9)15-3/h5-7H,4H2,1-3H3
SMILES:CCOC(=O)C(=O)c1cc(C)ccc1OC
Synonyms:
  • Benzeneacetic Acid, 2-Methoxy-5-Methyl-Α-Oxo-, Ethyl Ester
  • Ethyl (2-methoxy-5-methylphenyl)(oxo)acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.