CAS 85979-50-6
:4-(3-Fluorophenyl)-2-methylpyrimidine
Description:
4-(3-Fluorophenyl)-2-methylpyrimidine is an organic compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The compound features a 3-fluorophenyl group attached to the fourth position of the pyrimidine ring, contributing to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and can influence its reactivity and biological activity. Additionally, the methyl group at the second position of the pyrimidine ring can affect the compound's steric and electronic properties. This compound is of interest in medicinal chemistry and drug development due to its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various interactions with biological targets, making it a subject of research in pharmacology. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species.
Formula:C11H9FN2
InChI:InChI=1S/C11H9FN2/c1-8-13-6-5-11(14-8)9-3-2-4-10(12)7-9/h2-7H,1H3
InChI key:InChIKey=JPFCNAIVBQDQBI-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C2=NC(C)=NC=C2
Synonyms:- Pyrimidine, 4-(3-fluorophenyl)-2-methyl-
- 4-(3-Fluorophenyl)-2-methylpyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
