
CAS 85979-51-7
:4-(4-Fluorophenyl)-2-methylpyrimidine
Description:
4-(4-Fluorophenyl)-2-methylpyrimidine, with the CAS number 85979-51-7, is an organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a 4-fluorophenyl group attached to the pyrimidine ring, contributing to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and can influence its biological activity. Additionally, the methyl group at the 2-position of the pyrimidine ring affects its steric and electronic properties. This compound is typically used in medicinal chemistry and drug development, often serving as a building block for synthesizing more complex molecules. Its characteristics include moderate solubility in organic solvents and potential reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Overall, 4-(4-Fluorophenyl)-2-methylpyrimidine is of interest in research due to its potential applications in pharmaceuticals and agrochemicals.
Formula:C11H9FN2
InChI:InChI=1S/C11H9FN2/c1-8-13-7-6-11(14-8)9-2-4-10(12)5-3-9/h2-7H,1H3
InChI key:InChIKey=NWLUZGJNTVAQDO-UHFFFAOYSA-N
SMILES:CC=1N=C(C=CN1)C2=CC=C(F)C=C2
Synonyms:- Pyrimidine, 4-(4-fluorophenyl)-2-methyl-
- 4-(4-Fluorophenyl)-2-methylpyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
