CAS 859825-79-9
:7-benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine
Description:
7-benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a benzyl group and a chlorine atom, contributing to its unique chemical properties. The presence of the amino group at the 2-position enhances its potential for biological activity, making it of interest in medicinal chemistry. The tetrahydropyrido structure indicates that it is a saturated derivative, which may influence its solubility and reactivity. The chlorine substituent can affect the compound's electronic properties and may play a role in its interaction with biological targets. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would require empirical determination through experimental methods.
Formula:C14H15ClN4
InChI:InChI=1/C14H15ClN4/c15-13-11-6-7-19(8-10-4-2-1-3-5-10)9-12(11)17-14(16)18-13/h1-5H,6-9H2,(H2,16,17,18)
SMILES:c1ccc(cc1)CN1CCc2c(C1)[nH]c(=N)nc2Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine
CAS:Formula:C14H15ClN4Molecular weight:274.7487
