CAS 859826-41-8
:5,6,7,8-tetrahydro-3H-pyrido[4,3-e]pyrimidin-4-one hydrochloride (1:1)
Description:
5,6,7,8-tetrahydro-3H-pyrido[4,3-e]pyrimidin-4-one hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and methanol, which is indicative of its hydrochloride form. The presence of the hydrochloride group enhances its solubility and stability, making it suitable for various applications in medicinal chemistry. The compound may exhibit biological activity, potentially acting as a pharmacological agent, although specific biological properties would depend on further studies. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many chemical substances, proper handling and safety measures should be observed, given its classification and potential effects. Overall, this compound represents a unique scaffold that may be of interest in drug discovery and development.
Formula:C7H10ClN3O
InChI:InChI=1/C7H9N3O.ClH/c11-7-5-1-2-8-3-6(5)9-4-10-7;/h4,8H,1-3H2,(H,9,10,11);1H
SMILES:C1CNCc2c1c(ncn2)O.Cl
Synonyms:- 5,6,7,8-tetrahydro-3H-pyrido[4,3-e]pyrimidin-4-one hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6,7,8-Tetrahydropyrido[3,4-d]pyrimidin-4(3H)-one
CAS:Formula:C7H9N3OColor and Shape:SolidMolecular weight:151.1659
