CAS 85983-54-6

3-chloro-4-(3,5-dimethyl-1-piperidyl)aniline

Description:

3-Chloro-4-(3,5-dimethyl-1-piperidyl)aniline, with the CAS number 85983-54-6, is an organic compound characterized by its aromatic amine structure. It features a chloro substituent at the 3-position and a piperidine ring with two methyl groups at the 3 and 5 positions attached to the aniline moiety. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water can vary. The presence of the chloro group and the piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may also display specific reactivity patterns typical of amines and halogenated compounds, such as nucleophilic substitution reactions. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled. Overall, 3-chloro-4-(3,5-dimethyl-1-piperidyl)aniline is a compound of interest in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₉ClN₂

InChI: InChI=1/C13H19ClN2/c1-9-5-10(2)8-16(7-9)13-4-3-11(15)6-12(13)14/h3-4,6,9-10H,5,7-8,15H2,1-2H3

SMILES: CC1CC(C)CN(C1)c1ccc(cc1Cl)N

3-chloro-4-(3,5-dimethyl-1-piperidinyl)aniline

CAS: 85983-54-6

Formula: C₁₃H₁₉ClN₂

Purity: 95.0%

Molecular weight: 238.76

Ref: 10-F315743