CAS 859833-12-8
:1-(6-fluoro-4H-1,3-benzodioxin-8-yl)methanamine hydrochloride
Description:
1-(6-fluoro-4H-1,3-benzodioxin-8-yl)methanamine hydrochloride is a chemical compound characterized by its unique structure, which includes a benzodioxin moiety substituted with a fluorine atom and an amine functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The fluorine substitution can influence its biological activity and lipophilicity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The amine group may participate in hydrogen bonding, enhancing its interactions with biological targets. As with many compounds, safety and handling precautions are essential, as it may exhibit toxicity or irritant properties. Its specific applications and efficacy would depend on ongoing research and development in the context of drug discovery or other chemical applications.
Formula:C9H11ClFNO2
InChI:InChI=1/C9H10FNO2.ClH/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9;/h1-2H,3-5,11H2;1H
SMILES:c1c(CN)c2c(cc1F)COCO2.Cl
Synonyms:- (6-fluoro-4H-1,3-benzodioxin-8-yl)methylamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.