CAS 859833-18-4

1-(2-pyridin-3-ylphenyl)methanamine dihydrochloride

Description:

1-(2-Pyridin-3-ylphenyl)methanamine dihydrochloride, with the CAS number 859833-18-4, is a chemical compound characterized by its amine functional group and the presence of a pyridine ring. This substance typically appears as a white to off-white crystalline solid, indicating its solid-state at room temperature. It is soluble in water and polar organic solvents, which is common for amine derivatives. The compound's structure features a phenyl group attached to a pyridine ring, contributing to its potential biological activity and interactions. As a dihydrochloride salt, it is stabilized by the presence of hydrochloric acid, which enhances its solubility and stability in aqueous solutions. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation through empirical studies. Safety data should be consulted to ensure proper handling and usage, as with any chemical substance.

Formula: C₁₂H₁₄Cl₂N₂

InChI: InChI=1/C12H12N2.2ClH/c13-8-10-4-1-2-6-12(10)11-5-3-7-14-9-11;;/h1-7,9H,8,13H2;2*1H

SMILES: c1ccc(c(c1)CN)c1cccnc1.Cl.Cl

[2-(Pyridin-3-yl)phenyl]methylamine dihydrochloride

CAS: 859833-18-4

[2-(Pyridin-3-yl)phenyl]methylamine dihydrochloride

Purity: 97%

Color and Shape: Pale Yellow Solid

Molecular weight: 257.16g/mol

Ref: 54-OR3843