CAS 859850-95-6
:1-Methyl-1H-indole-4-methanol
Description:
1-Methyl-1H-indole-4-methanol, identified by its CAS number 859850-95-6, is a chemical compound that belongs to the indole family, which is characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features a methyl group at the nitrogen position and a hydroxymethyl group at the 4-position of the indole ring, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with biological systems. 1-Methyl-1H-indole-4-methanol may be of interest in various fields, including medicinal chemistry and materials science, due to its structural features that could impart biological activity or facilitate specific chemical reactions. As with many indole derivatives, it may also exhibit fluorescence properties, making it useful in certain analytical applications. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-11-6-5-9-8(7-12)3-2-4-10(9)11/h2-6,12H,7H2,1H3
InChI key:InChIKey=HRDMALIGWIPQLM-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(N(C)C=C2)=CC=C1
Synonyms:- (1-Methylindol-4-yl)methanol
- 1-Methyl-1H-indole-4-methanol
- 1H-indole-4-methanol, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
