CAS 859851-01-7

2,3-Dihydrothieno[3,4-b]-1,4-dioxin-5-methanol

Description:

2,3-Dihydrothieno[3,4-b]-1,4-dioxin-5-methanol is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thieno and a dioxin moiety. This compound features a five-membered dioxin ring fused to a thiophene ring, contributing to its distinct chemical properties. The presence of a hydroxymethyl group (-CH2OH) at the 5-position enhances its reactivity and solubility in polar solvents. Typically, compounds of this nature exhibit interesting biological activities, making them of interest in medicinal chemistry and materials science. The molecular structure allows for potential interactions with various biological targets, which may lead to applications in pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by the presence of substituents on the rings, affecting its overall chemical behavior. As with many heterocycles, the electronic properties and steric factors play a crucial role in determining its reactivity and potential applications in synthesis and drug development.

Formula: C₇H₈O₃S

InChI: InChI=1/C7H8O3S/c8-3-6-7-5(4-11-6)9-1-2-10-7/h4,8H,1-3H2

InChI key: InChIKey=LRWVQOFWMRDMHM-UHFFFAOYSA-N

SMILES: C(O)C1=C2C(=CS1)OCCO2

Synonyms:

• Thieno[3,4-b]-1,4-dioxin-5-methanol, 2,3-dihydro-
• 2,3-Dihydrothieno[3,4-b]-1,4-dioxin-5-methanol
• 2,3-Dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol
• 2-Hydroxymethyl-3,4-ethylenedioxythiophene
• 2,3-Dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol 97%

2,3-Dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol 97%

CAS: 859851-01-7

2,3-Dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanol 97%

Purity: 97%

Ref: 54-OR9982