CAS 859851-03-9

1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-N-methylmethanamine

Description:

1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-N-methylmethanamine, with the CAS number 859851-03-9, is a chemical compound characterized by its unique structural features, including a thieno[3,4-b][1,4]dioxin moiety and a N-methylmethanamine group. This compound is likely to exhibit properties typical of both heterocyclic compounds and amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of nitrogen. The thieno-dioxin structure may impart specific electronic properties, influencing its reactivity and interaction with biological systems. Compounds of this nature are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Additionally, the presence of the methyl group may enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, while specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical measurement, the structural characteristics suggest a compound of interest in medicinal chemistry.

Formula: C₈H₁₁NO₂S

InChI: InChI=1/C8H11NO2S/c1-9-4-7-8-6(5-12-7)10-2-3-11-8/h5,9H,2-4H2,1H3

SMILES: CNCc1c2c(cs1)OCCO2

2,3-Dihydro-5-[(methylamino)methyl]thieno[3,4-b][1,4]dioxine

CAS: 859851-03-9

2,3-Dihydro-5-[(methylamino)methyl]thieno[3,4-b][1,4]dioxine

Formula: C₈H₁₁NO₂S

Purity: 95%

Color and Shape: clear colourless liquid

Molecular weight: 185.24g/mol

Ref: 54-OR9137