CAS 859855-53-1

3-Amino-4-fluorobenzonitrile

Description:

3-Amino-4-fluorobenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), a fluorine atom, and a nitrile group (-C≡N) attached to a benzene ring. This compound features a fluorine atom at the para position relative to the nitrile group and an amino group at the meta position, which influences its reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the amino group allows for potential hydrogen bonding, while the nitrile group contributes to its polarity and can participate in various chemical reactions, such as nucleophilic substitutions. 3-Amino-4-fluorobenzonitrile is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as an intermediate in the synthesis of other chemical compounds. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₅FN₂

InChI: InChI=1/C7H5FN2/c8-6-2-1-5(4-9)3-7(6)10/h1-3H,10H2

SMILES: c1cc(c(cc1C#N)N)F

Synonyms:

• Benzonitrile, 3-Amino-4-Fluoro-

3-Amino-4-fluorobenzonitrile

CAS: 859855-53-1

Formula: C₇H₅FN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.1264

Ref: IN-DA003IVJ

3-Amino-4-fluorobenzonitrile

CAS: 859855-53-1

Formula: C₇H₅FN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.129

Ref: 10-F078069

3-Amino-4-fluorobenzonitrile

CAS: 859855-53-1

3-Amino-4-fluorobenzonitrile

Purity: 98%

Color and Shape: Solid

Molecular weight: 136.13g/mol

Ref: 54-PC1805