CAS 85987-88-8

2-cyano-N-hexadecylacetamide

Description:

2-Cyano-N-hexadecylacetamide, with the CAS number 85987-88-8, is a chemical compound characterized by its long hydrophobic hexadecyl chain and a cyano group attached to an acetamide moiety. This structure imparts both lipophilic and polar characteristics, making it potentially useful in various applications, including as a surfactant or in drug formulation. The presence of the cyano group contributes to its reactivity and may influence its interaction with biological systems. Typically, compounds like this can exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential biological activity, which may include antimicrobial or antifungal properties. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied. Overall, 2-cyano-N-hexadecylacetamide represents a class of compounds that bridge hydrophobic and hydrophilic domains, making them of interest in both industrial and pharmaceutical contexts.

Formula: C₁₉H₃₆N₂O

InChI: InChI=1/C19H36N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-19(22)16-17-20/h2-16,18H2,1H3,(H,21,22)

SMILES: CCCCCCCCCCCCCCCCN=C(CC#N)O

Synonyms:

• 2-Cyano-N-hexadecyl-acetamide
• Acetamide, 2-cyano-N-hexadecyl-

2-Cyano-N-hexadecylacetamide

CAS: 85987-88-8

Versatile small molecule scaffold

Formula: C₁₉H₃₆N₂O

Purity: Min. 95%

Molecular weight: 308.5 g/mol

Ref: 3D-KDA98788