CAS 85992-25-2
:1-chloronaphtho[2,1-b]thiophene-2-carbonyl chloride
Description:
1-Chloronaphtho[2,1-b]thiophene-2-carbonyl chloride is a chemical compound characterized by its unique structure, which combines elements of naphthalene and thiophene. This compound features a chlorinated naphthalene moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of a carbonyl chloride functional group indicates that it can participate in acylation reactions, making it useful in the synthesis of various derivatives. Its chlorinated structure may also impart specific electronic properties, influencing its behavior in chemical reactions and interactions with other substances. Typically, compounds like this are of interest in fields such as materials science, pharmaceuticals, and organic chemistry due to their potential as intermediates or building blocks in the synthesis of more complex molecules. Safety considerations are essential when handling this compound, as carbonyl chlorides can be reactive and potentially hazardous. Proper storage and handling protocols should be followed to mitigate risks associated with exposure.
Formula:C13H6Cl2OS
InChI:InChI=1/C13H6Cl2OS/c14-11-10-8-4-2-1-3-7(8)5-6-9(10)17-12(11)13(15)16/h1-6H
SMILES:c1ccc2c(c1)ccc1c2c(c(C(=O)Cl)s1)Cl
Synonyms:- Naphtho[2,1-B]Thiophene-2-Carbonyl Chloride, 1-Chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.