CAS 859979-73-0

ethyl 2-(4-methoxy-3-methyl-phenyl)-2-oxo-acetate

Description:

Ethyl 2-(4-methoxy-3-methyl-phenyl)-2-oxo-acetate, identified by its CAS number 859979-73-0, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a methoxy group and a methyl group on the aromatic ring, contributing to its unique chemical properties and potential reactivity. The presence of the 2-oxo-acetate moiety indicates that it can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Ethyl 2-(4-methoxy-3-methyl-phenyl)-2-oxo-acetate is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may exhibit moderate solubility in organic solvents, while its solubility in water could be limited due to the hydrophobic nature of the aromatic components. This compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules, although specific applications would depend on further research and development.

Formula: C₁₂H₁₄O₄

InChI: InChI=1/C12H14O4/c1-4-16-12(14)11(13)9-5-6-10(15-3)8(2)7-9/h5-7H,4H2,1-3H3

SMILES: CCOC(=O)C(=O)c1ccc(c(C)c1)OC

Synonyms:

• Benzeneacetic Acid, 4-Methoxy-3-Methyl-Α-Oxo-, Ethyl Ester
• Ethyl (4-methoxy-3-methylphenyl)(oxo)acetate
• benzeneacetic acid, 4-methoxy-3-methyl-伪-oxo-, ethyl ester