CAS 86-15-7
:4-(2,5-Dibutoxy-4-nitrophenyl)morpholine
Description:
4-(2,5-Dibutoxy-4-nitrophenyl)morpholine, identified by its CAS number 86-15-7, is an organic compound characterized by its morpholine structure linked to a nitrophenyl group that is further substituted with two butoxy groups. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its solubility in organic solvents. The presence of the nitro group introduces polar characteristics, which can influence its reactivity and interaction with other chemical species. Morpholine, a cyclic amine, imparts basicity and potential nucleophilicity to the molecule. The butoxy substituents enhance hydrophobic interactions, making the compound more lipophilic. This combination of functional groups suggests potential applications in fields such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors, such as pH and temperature, which are important considerations in its practical applications. Overall, 4-(2,5-Dibutoxy-4-nitrophenyl)morpholine is a versatile compound with unique chemical properties.
Formula:C18H28N2O5
InChI:InChI=1S/C18H28N2O5/c1-3-5-9-24-17-14-16(20(21)22)18(25-10-6-4-2)13-15(17)19-7-11-23-12-8-19/h13-14H,3-12H2,1-2H3
InChI key:InChIKey=MKVBADWWJFSRRK-UHFFFAOYSA-N
SMILES:O(CCCC)C1=C(C=C(OCCCC)C(N(=O)=O)=C1)N2CCOCC2
Synonyms:- 4-(2,5-Dibutoxy-4-nitrophenyl)morpholine
- Morpholine, 4-(2,5-dibutoxy-4-nitrophenyl)-
- 2,5-Dibutoxy-4-morpholinonitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
