CAS 860-43-5
:1-[2-[2-[2-[2-[5-Methyl-2-(1-methylethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethyl]piperidine
Description:
1-[2-[2-[2-[2-[5-Methyl-2-(1-methylethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethyl]piperidine, commonly referred to by its CAS number 860-43-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and multiple ethoxy groups. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents due to its hydrophobic aromatic components and ether linkages. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals and can interact with various biological targets. Additionally, the branched alkyl group (1-methylethyl) and the methyl substituent on the aromatic ring may influence its steric and electronic properties, potentially affecting its reactivity and interactions. While specific physical properties such as melting point, boiling point, and density are not detailed here, compounds of this nature often require careful handling due to their potential biological effects and should be studied in controlled environments.
Formula:C23H39NO4
InChI:InChI=1S/C23H39NO4/c1-20(2)22-8-7-21(3)19-23(22)28-18-17-27-16-15-26-14-13-25-12-11-24-9-5-4-6-10-24/h7-8,19-20H,4-6,9-18H2,1-3H3
InChI key:InChIKey=JNUDZGSSSWTMDN-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCN1CCCCC1)C2=C(C(C)C)C=CC(C)=C2
Synonyms:- Piperidine, 1-[2-[2-[2-[2-(thymyloxy)ethoxy]ethoxy]ethoxy]ethyl]-
- 1-[2-[2-[2-[2-[5-Methyl-2-(1-methylethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethyl]piperidine
- Piperidine, 1-[2-[2-[2-[2-[5-methyl-2-(1-methylethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethyl]-
- 1-[2-[2-[2-[2-(Thymyloxy)ethoxy]ethoxy]ethoxy]ethyl]piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Piperidine, 1-[2-[2-[2-[2-[5-methyl-2-(1-methylethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethyl]-
CAS:Formula:C23H39NO4Molecular weight:393.5601
