CAS 860010-33-9
:Ethyl 4-(8-chloro-4-cyano-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate
Description:
Ethyl 4-(8-chloro-4-cyano-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate is a complex organic compound characterized by its unique structural features, including a piperidine ring and a benzo-cyclohepta-pyridine moiety. This substance is notable for its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of a chloro group and a cyano group in its structure may contribute to its reactivity and interaction with biological targets. The ethyl ester functional group suggests that it may undergo hydrolysis to release the corresponding carboxylic acid, which can influence its solubility and bioavailability. Additionally, the compound's intricate structure may lead to interesting stereochemical properties, affecting its interaction with enzymes or receptors. Overall, this compound exemplifies the complexity often found in drug-like molecules, making it a subject of interest in research focused on developing new therapeutic agents.
Formula:C23H22ClN3O2
InChI:InChI=1S/C23H22ClN3O2/c1-2-29-23(28)27-11-8-15(9-12-27)21-19-6-4-18(24)13-16(19)3-5-20-17(14-25)7-10-26-22(20)21/h4,6-7,10,13H,2-3,5,8-9,11-12H2,1H3
InChI key:InChIKey=SEMUBDLGVZWDDH-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(C(C=3C(CC2)=CC(Cl)=CC3)=C4CCN(C(OCC)=O)CC4)=NC=C1
Synonyms:- Ethyl 4-(8-chloro-4-cyano-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-(8-chloro-4-cyano-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-, ethyl ester
- 4-Cyano Loratadine
- 4-(8-Chloro-4-cyano-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-Piperidinecarboxylic Acid Ethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Cyano Loratadine
CAS:Controlled ProductApplications Intermediate for the synthesis of 4-Hydroxymethyl Loratadine.
References Cerrada, V., et al.: ARKIVOC, 9, 200 (2005).Formula:C23H22ClN3O2Color and Shape:NeatMolecular weight:407.89
