CymitQuimica logo

CAS 860024-94-8

:

1H-Indole-1-carboxylic acid, 5-(2-chloroethyl)-2,3-dihydro-, 1,1-diMethylethyl ester

Description:
1H-Indole-1-carboxylic acid, 5-(2-chloroethyl)-2,3-dihydro-, 1,1-diMethyl ethyl ester, identified by CAS number 860024-94-8, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of a carboxylic acid functional group, which is esterified with a tert-butyl group, contributing to its lipophilicity and potential biological activity. The chloroethyl substituent at the 5-position of the indole ring may impart unique reactivity and pharmacological properties, making it of interest in medicinal chemistry. The dihydro form indicates that the compound has undergone partial hydrogenation, affecting its stability and reactivity. Overall, this compound may exhibit various biological activities, including potential applications in drug development, but specific properties such as solubility, melting point, and biological activity would require empirical investigation for detailed characterization.
Formula:C15H20ClNO2
InChI:InChI=1S/C15H20ClNO2/c1-15(2,3)19-14(18)17-9-7-12-10-11(6-8-16)4-5-13(12)17/h4-5,10H,6-9H2,1-3H3
InChI key:WSOGILKNZBKVPB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2=C1C=CC(=C2)CCCl
Found 2 products.