CAS 860034-13-5
:B-(5-Cyano-2-nitrophenyl)boronic acid
Description:
B-(5-Cyano-2-nitrophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with both a cyano group and a nitro group. This compound typically exhibits properties such as high stability under ambient conditions, making it suitable for various applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for reversible covalent bonding with diols, which is particularly useful in the development of sensors and in the field of drug discovery. The presence of the cyano and nitro groups contributes to its electronic properties, potentially enhancing its reactivity and solubility in polar solvents. Additionally, the compound may exhibit interesting photophysical properties due to the presence of the nitro group, which can influence its absorption and emission characteristics. Overall, B-(5-Cyano-2-nitrophenyl)boronic acid is a versatile building block in synthetic chemistry, particularly in the development of complex organic molecules.
Formula:C7H5BN2O4
InChI:InChI=1S/C7H5BN2O4/c9-4-5-1-2-7(10(13)14)6(3-5)8(11)12/h1-3,11-12H
InChI key:InChIKey=CCDBEDZKWQIRKB-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(N(=O)=O)C=CC(C#N)=C1
Synonyms:- Boronic acid, (5-cyano-2-nitrophenyl)-
- B-(5-Cyano-2-nitrophenyl)boronic acid
- Boronic acid, B-(5-cyano-2-nitrophenyl)-
- (5-Cyano-2-nitrophenyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
