CAS 860035-10-5

Propanoic acid, 2-methyl-, 1-[[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]oxy]ethyl ester

Description:

Propanoic acid, 2-methyl-, 1-[[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]oxy]ethyl ester, identified by CAS number 860035-10-5, is an organic compound characterized by its ester functional group and a complex molecular structure. This compound features a propanoic acid backbone with a methyl group at the second carbon, contributing to its branched nature. The presence of a pyrrolidinyl moiety indicates potential biological activity, as pyrrolidine derivatives are often associated with various pharmacological properties. The esterification of the propanoic acid with a carbonyl-oxy group suggests that it may exhibit moderate to high lipophilicity, influencing its solubility and reactivity. Additionally, the presence of multiple functional groups implies that this compound could participate in various chemical reactions, such as hydrolysis or transesterification. Its unique structure may also confer specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₁H₁₅NO₇

InChI: InChI=1S/C11H15NO7/c1-6(2)10(15)17-7(3)18-11(16)19-12-8(13)4-5-9(12)14/h6-7H,4-5H2,1-3H3

InChI key: InChIKey=NIJJEANUXNRGNK-UHFFFAOYSA-N

SMILES: O(C(OC(OC(C(C)C)=O)C)=O)N1C(=O)CCC1=O

Synonyms:

• 1-((((2,5-Dioxopyrrolidin-1-yl)oxy)carbonyl)oxy)ethyl isobutyrate
• 1-((2,5-Dioxopyrroldin-1-Yloxy)Carbonyloxy)Ethyl Isobutyrate
• 1-[[[(2,5-Dioxopyrrolidin-1-yl)oxy]carbonyl]oxy]ethyl 2-methylpropanoate
• N-[[1-(Isobutanoyloxy)ethoxy]carbonyloxy]succinimide
• Propanoic acid, 2-methyl-, 1-[[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]oxy]ethyl ester

1-((2,5-DIOXOPYRROLIDIN-1-YLOXY)CARBONYLOXY)ETHYL ISOBUTYRATE

CAS: 860035-10-5

Formula: C₁₁H₁₅NO₇

Purity: 95%

Molecular weight: 273.241

Ref: 10-F527401