CAS 860036-29-9
:Benzenepropanamide, N,N′-(1R,2R)-1,2-cyclohexanediylbis[N-hydroxy-β,β-diphenyl-
Description:
Benzenepropanamide, N,N′-(1R,2R)-1,2-cyclohexanediylbis[N-hydroxy-β,β-diphenyl- is a complex organic compound characterized by its structural features, which include a benzene ring and a cyclohexanediyl moiety. The presence of the N-hydroxy groups indicates that this compound may exhibit interesting reactivity and potential biological activity, possibly acting as a ligand or a pharmaceutical agent. The stereochemistry denoted by (1R,2R) suggests specific spatial arrangements of atoms, which can significantly influence the compound's properties, including its solubility, melting point, and interaction with biological targets. The diphenyl groups contribute to the compound's hydrophobic character, which may affect its bioavailability and interaction with lipid membranes. Additionally, the CAS number 860036-29-9 allows for precise identification and retrieval of information regarding this substance in chemical databases. Overall, this compound's unique structure may lead to diverse applications in medicinal chemistry and materials science, warranting further investigation into its properties and potential uses.
Formula:C48H46N2O4
InChI:InChI=1S/C48H46N2O4/c51-45(35-47(37-21-7-1-8-22-37,38-23-9-2-10-24-38)39-25-11-3-12-26-39)49(53)43-33-19-20-34-44(43)50(54)46(52)36-48(40-27-13-4-14-28-40,41-29-15-5-16-30-41)42-31-17-6-18-32-42/h1-18,21-32,43-44,53-54H,19-20,33-36H2/t43-,44-/m1/s1
InChI key:InChIKey=VWHFLRGVWVBFFY-NDOUMJCMSA-N
SMILES:C(CC(N(O)[C@H]1[C@H](N(C(CC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)=O)O)CCCC1)=O)(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7
Synonyms:- Benzenepropanamide, N,N′-(1R,2R)-1,2-cyclohexanediylbis[N-hydroxy-β,β-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,2R)-N,N'-Dihydroxy-N,N'-bis(3,3,3-triphenylpropionyl)cyclohexane-1,2-diamine
CAS:Formula:C48H46N2O4Molecular weight:714.8898
