CAS 86011-33-8
:hydroxymethyl acetate
Description:
Hydroxymethyl acetate, with the CAS number 86011-33-8, is an organic compound characterized by the presence of both hydroxymethyl and acetate functional groups. It typically appears as a colorless to pale yellow liquid with a mild, sweet odor. This compound is soluble in water and organic solvents, making it versatile for various applications. Hydroxymethyl acetate is primarily used as an intermediate in the synthesis of other chemicals, particularly in the production of polymers and resins. Its chemical structure allows it to participate in various chemical reactions, including esterification and nucleophilic substitution. Additionally, it exhibits properties that make it useful in formulations for coatings, adhesives, and other industrial applications. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, hydroxymethyl acetate is a valuable compound in the chemical industry due to its reactivity and functional versatility.
Formula:C3H6O3
InChI:InChI=1/C3H6O3/c1-3(5)6-2-4/h4H,2H2,1H3
SMILES:CC(=O)OCO
Synonyms:- Methanediol, Monoacetate
- Hydroxymethyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.