CAS 86015-38-5
:1-{1-[3-(6-fluoro-1,2-benzoxazol-3-yl)propyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one
Description:
The chemical substance known as 1-{1-[3-(6-fluoro-1,2-benzoxazol-3-yl)propyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one, with the CAS number 86015-38-5, is a complex organic compound characterized by its unique structural features. It contains a benzimidazole core, which is fused with a piperidine ring and substituted with a propyl group linked to a 6-fluoro-1,2-benzoxazole moiety. This compound exhibits potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the fluorine atom may enhance its lipophilicity and biological interactions. Additionally, the compound's structural diversity suggests it may interact with various biological targets, potentially influencing its pharmacological properties. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its stability, solubility, and reactivity would be essential for evaluating its practical applications in drug development. As with many such compounds, further studies would be necessary to fully understand its mechanism of action and therapeutic potential.
Formula:C22H23FN4O2
InChI:InChI=1/C22H23FN4O2/c23-15-7-8-17-18(25-29-21(17)14-15)5-3-11-26-12-9-16(10-13-26)27-20-6-2-1-4-19(20)24-22(27)28/h1-2,4,6-8,14,16H,3,5,9-13H2,(H,24,28)
SMILES:c1ccc2c(c1)nc(n2C1CCN(CCCc2c3ccc(cc3on2)F)CC1)O
Synonyms:- 1-(1-(3-(6-Fluoro-1,2-benzisoxazol-3-yl)propyl)-4-piperidinyl)-1,3-dihydro-2H-benzimidazol-2-one
- Neflumozide
- P79 9313
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Neflumozide Hydrochloride
CAS:Controlled ProductFormula:C22H23FN4O2·ClHColor and Shape:NeatMolecular weight:430.903Neflumozide hydrochloride
CAS:<p>Neflumozide is a drug product with CAS No. 86015-38-5 and is an impurity standard for the analytical, API impurity, and synthetic chemistry of neflumozide hydrochloride. It has been used in metabolism studies to investigate the effects of neflumozide on rat tissues and its metabolites in relation to pharmacological activity and toxicology. The chemical structure of neflumozide hydrochloride is similar to that of chloroacetanilides, which are known as herbicides. Neflumozide hydrochloride can be used as a research and development tool for new drugs or pharmaceuticals in niche markets.</p>Formula:C22H24ClFN4O2Purity:Min. 95%Molecular weight:430.90 g/mol

