CAS 860193-28-8

6-Chloro-8-methyl-4(3H)-quinazolinone

Description:

6-Chloro-8-methyl-4(3H)-quinazolinone is a synthetic organic compound characterized by its quinazolinone structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. The presence of a chlorine atom at the 6-position and a methyl group at the 8-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and is soluble in organic solvents, which may include dimethyl sulfoxide (DMSO) and ethanol, but has limited solubility in water. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit activities such as anti-inflammatory or anticancer effects. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine substituent and the overall electron distribution in the quinazolinone framework. As with many chemical substances, safety precautions should be observed when handling it, and its use should be guided by appropriate regulatory and safety guidelines.

Formula: C₉H₇ClN₂O

InChI: InChI=1S/C9H7ClN2O/c1-5-2-6(10)3-7-8(5)11-4-12-9(7)13/h2-4H,1H3,(H,11,12,13)

InChI key: InChIKey=NQEXBJHCIVDMPU-UHFFFAOYSA-N

SMILES: CC1=C2C(=CC(Cl)=C1)C(=O)N=CN2

Synonyms:

• 4(3H)-Quinazolinone, 6-chloro-8-methyl-
• 6-Chloro-8-methyl-4(3H)-quinazolinone