CymitQuimica logo

CAS 860206-90-2

:

8-Quinolinecarboxylic acid, 3-bromo-6-chloro-

Description:
8-Quinolinecarboxylic acid, 3-bromo-6-chloro- is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid functional group (-COOH) at the 8-position, contributing to its acidic properties. The presence of bromine and chlorine substituents at the 3 and 6 positions, respectively, introduces halogen functionalities that can influence the compound's reactivity and solubility. Typically, such halogenated compounds exhibit unique chemical behaviors, including potential for electrophilic substitution reactions. The molecular structure suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. Additionally, the compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would require empirical investigation. Overall, 8-Quinolinecarboxylic acid, 3-bromo-6-chloro- is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C10H5BrClNO2
InChI:InChI=1S/C10H5BrClNO2/c11-6-1-5-2-7(12)3-8(10(14)15)9(5)13-4-6/h1-4H,(H,14,15)
InChI key:InChIKey=KOEMCPLCSXGKMD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C=C(Cl)C1)C=C(Br)C=N2
Synonyms:
  • 8-Quinolinecarboxylic acid, 3-bromo-6-chloro-
  • 3-Bromo-6-chloroquinoline-8-carboxylicacid
  • 3-Bromo-6-chloroquinoline-8-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.