CymitQuimica logo

CAS 860225-12-3

:

2-Piperazineacetic acid, 3-oxo-, hydrochloride (1:1)

Description:
2-Piperazineacetic acid, 3-oxo-, hydrochloride (1:1) is a chemical compound characterized by its piperazine ring structure, which is a six-membered cyclic amine. This compound features an acetic acid moiety and a keto group, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as being a zwitterion, depending on the pH of the solution, which can influence its pharmacokinetics and pharmacodynamics. Its molecular structure allows for various functional group interactions, which can be crucial in drug design and development. Overall, 2-Piperazineacetic acid, 3-oxo-, hydrochloride (1:1) is a compound of interest for research in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C6H10N2O3·ClH
InChI:InChI=1S/C6H10N2O3.ClH/c9-5(10)3-4-6(11)8-2-1-7-4;/h4,7H,1-3H2,(H,8,11)(H,9,10);1H
InChI key:InChIKey=RHWYDHZAVDITNA-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C(=O)NCCN1.Cl
Synonyms:
  • 2-Piperazineacetic acid, 3-oxo-, hydrochloride (1:1)
  • 2-(3-Oxopiperazin-2-yl)acetic acid hydrochloride
  • 2-Piperazineacetic acid, 3-oxo-, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.