CAS 860265-69-6

rel-(1R,1aR,7bS)-1,1a,2,7b-Tetrahydrobenzo[b]cyclopropa[d]pyran-1-carboxylic acid

Description:

The chemical substance known as rel-(1R,1aR,7bS)-1,1a,2,7b-Tetrahydrobenzo[b]cyclopropa[d]pyran-1-carboxylic acid, with the CAS number 860265-69-6, is a bicyclic compound characterized by its unique structural features, including a tetrahydrobenzo[b]cyclopropa[d]pyran framework. This compound exhibits chirality, indicated by its specific stereochemical configuration at multiple chiral centers, which can influence its biological activity and interactions. The presence of a carboxylic acid functional group suggests potential acidity and reactivity, allowing for various chemical transformations. Its molecular structure may contribute to specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by its stereochemistry and functional groups, which are critical for applications in drug development and synthesis. Overall, this compound represents a complex and intriguing structure within organic chemistry, with potential implications in various scientific fields.

Formula: C₁₁H₁₀O₃

InChI: InChI=1/C11H10O3/c12-11(13)10-7-5-14-8-4-2-1-3-6(8)9(7)10/h1-4,7,9-10H,5H2,(H,12,13)/t7-,9+,10+/s2

InChI key: InChIKey=PFHGDLDIFTYQNA-RLZPTSKSNA-N

SMILES: C(O)(=O)[C@H]1[C@]2([C@@]1(COC=3C2=CC=CC3)[H])[H]

Synonyms:

• Benzo[b]cyclopropa[d]pyran-1-carboxylic acid, 1,1a,2,7b-tetrahydro-, (1R,1aR,7bS)-rel-
• rel-(1R,1aR,7bS)-1,1a,2,7b-Tetrahydrobenzo[b]cyclopropa[d]pyran-1-carboxylic acid

(1R,1aR,7bS)-1,1a,2,7b-Tetrahydrocyclopropa[c]chromene-1-carboxylic acid

CAS: 860265-69-6

Formula: C₁₁H₁₀O₃

Molecular weight: 190.1953

Ref: IN-DA008FR0