
CAS 860297-50-3
:1-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde
Description:
1-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine structures, which contribute to its unique chemical properties. This compound features a carboxaldehyde functional group, making it reactive and capable of participating in various chemical reactions, such as nucleophilic additions and condensation reactions. The presence of the methyl group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen-containing rings that can interact with biological targets. Additionally, the compound may exhibit interesting optical and electronic properties, making it a candidate for research in materials science. As with many heterocycles, its reactivity and stability can be influenced by environmental factors such as pH and temperature, which are important considerations in both synthetic and application contexts.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c1-11-5-7(6-12)8-2-3-10-4-9(8)11/h2-6H,1H3
InChI key:InChIKey=ZUXVPNLOYRJJDA-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(N(C)C1)=CN=CC2
Synonyms:- 1-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde
- 1-Methyl-1H-pyrrolo[2,3-c]pyridine-3-carbaldehyde
- 1H-Pyrrolo[2,3-c]pyridine-3-carboxaldehyde, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.