CAS 86030-43-5

chloro(diisopropylamino)methoxyphosphine

Description:

Chloro(diisopropylamino)methoxyphosphine, with the CAS number 86030-43-5, is a chemical compound that belongs to the class of organophosphorus compounds. It features a phosphorus atom bonded to a chlorine atom, a methoxy group, and two diisopropylamino groups, which contribute to its unique properties. This compound is typically characterized by its reactivity, particularly due to the presence of the phosphorus-chlorine bond, which can participate in nucleophilic substitution reactions. The diisopropylamino groups enhance its solubility in organic solvents and may influence its biological activity, making it of interest in various chemical applications, including potential use in pharmaceuticals or agrochemicals. Additionally, the methoxy group can affect the electronic properties of the molecule, influencing its reactivity and interactions with other substances. Safety precautions are essential when handling this compound, as organophosphorus compounds can exhibit toxicity and environmental persistence. Overall, chloro(diisopropylamino)methoxyphosphine is a versatile compound with significant implications in chemical synthesis and research.

Formula: C₇H₁₇ClNOP

InChI: InChI=1/C7H17ClNOP/c1-6(2)9(7(3)4)11(8)10-5/h6-7H,1-5H3

SMILES: CC(C)N(C(C)C)P(Cl)OC

Synonyms:

• N,N-diisopropylmethylphosphonamidic chloride
• methyl N,N-diisopropylchlorophosphoramidite
• Methyl Bis(1-Methylethyl)Amidochlorophosphite

CHLORO(DIISOPROPYLAMINO)METHOXYPHOSPHINE

CAS: 86030-43-5

Formula: C₇H₁₇ClNOP

Purity: 95%

Color and Shape: Liquid

Molecular weight: 197.6427

Ref: IN-DA0035BA