CAS 86030-63-9
:ile-ser-bradykinin acetate
Description:
Ile-ser-bradykinin acetate, identified by the CAS number 86030-63-9, is a synthetic peptide that is a derivative of bradykinin, a potent vasodilator involved in various physiological processes, including inflammation and blood pressure regulation. This compound is characterized by its specific amino acid sequence, which includes isoleucine (Ile) and serine (Ser) modifications that enhance its biological activity and stability compared to the natural form of bradykinin. The acetate form indicates that the peptide is acetylated, which can influence its solubility and bioavailability. Ile-ser-bradykinin acetate is typically studied for its potential therapeutic applications, particularly in cardiovascular and inflammatory conditions. Its mechanism of action involves binding to bradykinin receptors, leading to various cellular responses. As with many peptides, its stability can be affected by factors such as pH and temperature, and it may require specific storage conditions to maintain its integrity. Overall, this compound represents a valuable tool in pharmacological research and potential clinical applications.
Formula:C59H89N17O14
InChI:InChI=1/C59H89N17O14/c1-3-34(2)47(60)53(85)72-41(32-77)50(82)69-37(19-10-24-65-58(61)62)54(86)76-28-14-23-45(76)56(88)75-27-12-21-43(75)51(83)67-31-46(79)68-39(29-35-15-6-4-7-16-35)48(80)73-42(33-78)55(87)74-26-13-22-44(74)52(84)71-40(30-36-17-8-5-9-18-36)49(81)70-38(57(89)90)20-11-25-66-59(63)64/h4-9,15-18,34,37-45,47,77-78H,3,10-14,19-33,60H2,1-2H3,(H,67,83)(H,68,79)(H,69,82)(H,70,81)(H,71,84)(H,72,85)(H,73,80)(H,89,90)(H4,61,62,65)(H4,63,64,66)/t34-,37-,38-,39-,40-,41-,42-,43-,44-,45-,47-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](CO)C(=N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=NCC(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CO)C(=O)N1CCC[C@H]1C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)O)O)O)O)N
Synonyms:- T-Kinin
- Bradykinin, ile-ser-
- Bradykinin, isoleucyl-serine-
- Ile-ser-arg-pro-pro-gly-phe-ser-pro-phe-arg
- Ile-ser-bradykinin
- Bradykinin, N2-(N-L-isoleucyl-L-seryl)-
- L-isoleucyl-L-seryl-N~5~-(diaminomethylidene)-L-ornithyl-L-prolyl-L-prolylglycyl-L-phenylalanyl-L-seryl-L-prolyl-L-phenylalanyl-N~5~-(diaminomethylidene)-L-ornithine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
T-kinin
CAS:T-kinin (Ile-Ser-bradykinin) is a bradykinin-containing peptide utilized in inflammation research [1] [2].Formula:C59H89N17O14Molecular weight:1260.44Isoleucyl-Seryl-Bradykinin
CAS:<p>Isoleucyl-Seryl-Bradykinin is a peptide that activates the bradykinin receptor, which is involved in pain sensation and inflammation. This compound is a potent inhibitor of ion channels and also interacts with protein receptors. Isoleucyl-Seryl-Bradykinin has been used as a research tool for studying the function of bradykinin receptors, as well as for pharmacological studies. The CAS number for this product is 86030-63-9.</p>Formula:C59H89N17O14Purity:Min. 95%Molecular weight:1,260.4 g/mol


