CAS 860411-74-1

2-(hydroxymethyl)pyridin-4(1H)-one

Description:

2-(Hydroxymethyl)pyridin-4(1H)-one, with the CAS number 860411-74-1, is a chemical compound characterized by its pyridine ring structure substituted with a hydroxymethyl group and a keto group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the hydroxymethyl group. It may participate in hydrogen bonding due to the hydroxyl group, influencing its reactivity and interactions with other molecules. The keto group can also engage in tautomeric shifts, which may affect its stability and reactivity under different conditions. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Its specific applications and behavior can vary based on the surrounding environment, such as pH and temperature, making it a versatile compound in research and industrial applications.

Formula: C₆H₇NO₂

InChI: InChI=1/C6H7NO2/c8-4-5-3-6(9)1-2-7-5/h1-3,8H,4H2,(H,7,9)

SMILES: c1c[nH]c(cc1=O)CO

Synonyms:

• 2-(Hydroxymethyl)pyridin-4-ol
• 2-Pyridinemethanol, 4-Hydroxy-

2-(Hydroxymethyl)Pyridin-4-Ol

CAS: 860411-74-1

Formula: C₆H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 125.1253

Ref: IN-DA01DKLK

2-(Hydroxymethyl)pyridin-4-ol

CAS: 860411-74-1

2-(Hydroxymethyl)pyridin-4-ol

Purity: 95%

Molecular weight: 125.13g/mol

Ref: 54-OR91972

2-(Hydroxymethyl)pyridin-4-ol

CAS: 860411-74-1

2-(Hydroxymethyl)pyridin-4-ol is a versatile building block that can be used in the synthesis of complex compounds and research chemicals. This fine chemical is a reagent, speciality chemical, and useful scaffold in organic synthesis. 2-(Hydroxymethyl)pyridin-4-ol is also an intermediate for the production of useful building blocks. It has high purity and can be used as a reaction component or a useful scaffold in organic synthesis.

Formula: C₆H₇NO₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 125.13 g/mol

Ref: 3D-FH143248

2-(hydroxymethyl)-1,4-dihydropyridin-4-one

CAS: 860411-74-1

Purity: 95%

Molecular weight: 125.1269989

Ref: 10-F611412